EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | CC(CCCC(C)C(=O)O)COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H22O6/c1-11(6-5-7-12(2)15(18)19)10-23-17(22)14-9-4-3-8-13(14)16(20)21/h3-4,8-9,11-12H,5-7,10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | JJZDVFQRUJRRSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono(6-carboxy-2-methylheptyl) phthalate (CHEBI:132574) is a dicarboxylic acid (CHEBI:35692) |
| mono(6-carboxy-2-methylheptyl) phthalate (CHEBI:132574) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-{[(6-carboxy-2-methylheptyl)oxy]carbonyl}benzoic acid |
| Synonym | Source |
|---|---|
| mono(6-COOH-2-methylheptyl) phthalate | ChEBI |