EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO10S3 |
| Net Charge | 0 |
| Average Mass | 479.595 |
| Monoisotopic Mass | 479.09536 |
| SMILES | CS(=O)CCCCCCCC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H29NO10S3/c1-28(21)8-6-4-2-3-5-7-11(16-26-29(22,23)24)27-15-14(20)13(19)12(18)10(9-17)25-15/h10,12-15,17-20H,2-9H2,1H3,(H,22,23,24)/t10-,12-,13+,14-,15+,28?/m1/s1 |
| InChIKey | LQZALQLZOQQFGM-MMLSCURJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS338) | |
| Armoracia rusticana (ncbitaxon:3704) | root (BTO:0001188) | PubMed (22779710) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoibarin (CHEBI:132553) has role plant metabolite (CHEBI:76924) |
| glucoibarin (CHEBI:132553) is a glucosinolic acid (CHEBI:79316) |
| glucoibarin (CHEBI:132553) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1-S-[8-(methanesulfinyl)-N-(sulfooxy)octanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 7-(Methylsulfinyl)heptyl glucosinolate | KNApSAcK |
| 7-(methylsulfinyl)heptyl glucosinolic acid | ChEBI |
| Citations |
|---|