EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O2 |
| Net Charge | 0 |
| Average Mass | 114.104 |
| Monoisotopic Mass | 114.04293 |
| SMILES | N#CCC(N)C(=O)O |
| InChI | InChI=1S/C4H6N2O2/c5-2-1-3(6)4(7)8/h3H,1,6H2,(H,7,8) |
| InChIKey | BXRLWGXPSRYJDZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS338) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-cyanoalanine (CHEBI:132546) is a alanine derivative (CHEBI:22278) |
| 3-cyanoalanine (CHEBI:132546) is a aliphatic nitrile (CHEBI:80291) |
| 3-cyanoalanine (CHEBI:132546) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| 2-amino-3-cyanopropanoic acid |
| Synonyms | Source |
|---|---|
| beta-Cyanoalanine | ChemIDplus |
| cyanoalanine | ChEBI |
| propargylglycine | ChEBI |
| β-cyanoalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2410687 | Reaxys |
| CAS:923-01-3 | ChemIDplus |
| Citations |
|---|