EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N3O3 |
| Net Charge | 0 |
| Average Mass | 369.465 |
| Monoisotopic Mass | 369.20524 |
| SMILES | O=C1C[C@@H](c2ccccc2)NCCCCN(C(=O)c2ccoc2)CCCN1 |
| InChI | InChI=1S/C21H27N3O3/c25-20-15-19(17-7-2-1-3-8-17)22-10-4-5-12-24(13-6-11-23-20)21(26)18-9-14-27-16-18/h1-3,7-9,14,16,19,22H,4-6,10-13,15H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | CNJPJUFFFBTCBZ-IBGZPJMESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celafurine (CHEBI:132513) is a azamacrocycle (CHEBI:52898) |
| celafurine (CHEBI:132513) is a furans (CHEBI:24129) |
| celafurine (CHEBI:132513) is a lactam (CHEBI:24995) |
| celafurine (CHEBI:132513) is a spermidine alkaloid (CHEBI:38524) |
| IUPAC Name |
|---|
| (2S)-9-(furan-3-carbonyl)-2-phenyl-1,5,9-triazacyclotridecan-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8013240 | Reaxys |