EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20ClN5O3 |
| Net Charge | 0 |
| Average Mass | 377.832 |
| Monoisotopic Mass | 377.12547 |
| SMILES | CNc1nc(Nc2ccc(C(=O)N3CCOCC3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C17H20ClN5O3/c1-19-15-12(18)10-20-17(22-15)21-13-4-3-11(9-14(13)25-2)16(24)23-5-7-26-8-6-23/h3-4,9-10H,5-8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | YEVOZZZLKJKCCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HG-10-102-01 (CHEBI:132509) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| HG-10-102-01 (CHEBI:132509) is a aminopyrimidine (CHEBI:38338) |
| HG-10-102-01 (CHEBI:132509) is a aromatic ether (CHEBI:35618) |
| HG-10-102-01 (CHEBI:132509) is a monocarboxylic acid amide (CHEBI:29347) |
| HG-10-102-01 (CHEBI:132509) is a morpholines (CHEBI:38785) |
| HG-10-102-01 (CHEBI:132509) is a organochlorine compound (CHEBI:36683) |
| HG-10-102-01 (CHEBI:132509) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (4-{[5-chloro-4-(methylamino)pyrimidin-2-yl]amino}-3-methoxyphenyl)(morpholin-4-yl)methanone |
| Citations |
|---|