EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO4S |
| Net Charge | 0 |
| Average Mass | 411.608 |
| Monoisotopic Mass | 411.24433 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C22H37NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)23-20-21-28(25,26)27/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21H2,1H3,(H,23,24)(H,25,26,27)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | YUNYSWCRLRYOPO-DOFZRALJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (18311922) |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoyltaurine (CHEBI:132506) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoyltaurine (CHEBI:132506) has role mouse metabolite (CHEBI:75771) |
| N-arachidonoyltaurine (CHEBI:132506) is a fatty acid-taurine conjugate (CHEBI:132474) |
| N-arachidonoyltaurine (CHEBI:132506) is conjugate acid of N-arachidonoyltaurine(1−) (CHEBI:132060) |
| Incoming Relation(s) |
| N-arachidonoyltaurine(1−) (CHEBI:132060) is conjugate base of N-arachidonoyltaurine (CHEBI:132506) |
| IUPAC Name |
|---|
| 2-{[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino}ethane-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| N-arachidonoyl-taurine | ChEBI |
| N-(5Z,8Z,11Z,14Z)-icosatetraenoyl-taurine | ChEBI |
| N-(5Z,8Z,11Z,14Z)-eicosatetraenoyl-taurine | ChEBI |
| N-(5Z,8Z,11Z,14Z)-eicosatetraenoyltaurine | ChEBI |
| N-(5Z,8Z,11Z,14Z)-icosatetraenoyltaurine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22828290 | Reaxys |
| CAS:119959-65-8 | ChemIDplus |
| Citations |
|---|