EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3D7NO2 |
| Net Charge | 0 |
| Average Mass | 96.137 |
| Monoisotopic Mass | 96.09162 |
| SMILES | [2H]OC(=O)C([2H])(N([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i1D3,2D/hD3 |
| InChIKey | QNAYBMKLOCPYGJ-UQEXSWPGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS292) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alanine-d7 (CHEBI:132498) is a alanine (CHEBI:16449) |
| alanine-d7 (CHEBI:132498) is a deuterated compound (CHEBI:76107) |
| IUPAC Name |
|---|
| (2H7)alanine |
| Synonym | Source |
|---|---|
| heptadeuteroalanine | ChEBI |