EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O3 |
| Net Charge | 0 |
| Average Mass | 400.603 |
| Monoisotopic Mass | 400.29775 |
| SMILES | [H]C(=O)C1=CC[C@@]2([H])[C@]3(C)CC[C@@]4([H])C(C)(C)CCC[C@]4(C)[C@@]3([H])C[C@@H](OC(C)=O)[C@]2(C)C1 |
| InChI | InChI=1S/C26H40O3/c1-17(28)29-22-14-21-24(4)12-7-11-23(2,3)19(24)10-13-25(21,5)20-9-8-18(16-27)15-26(20,22)6/h8,16,19-22H,7,9-15H2,1-6H3/t19-,20-,21+,22+,24-,25-,26+/m0/s1 |
| InChIKey | PTMXVTMFEPDKJQ-GAZMYWJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | MetaboLights (MTBLS91) | ||
| - | PubMed (26364855) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyrtial (CHEBI:132487) has role marine metabolite (CHEBI:76507) |
| hyrtial (CHEBI:132487) is a acetate ester (CHEBI:47622) |
| hyrtial (CHEBI:132487) is a enal (CHEBI:51688) |
| hyrtial (CHEBI:132487) is a scalarane sesterterpenoid (CHEBI:59370) |
| Synonyms | Source |
|---|---|
| 12β-acetoxy-25-nor-16-scalaren-24-al | ChEBI |
| (4aS,4bR,6R,6aR,10aS,10bR,12aS)-8-formyl-1,1,4a,6a,10b-pentamethyl-1,2,3,4,4a,4b,5,6,6a,7,10,10a,10b,11,12,12a-hexadecahydrochrysen-6-yl acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:97889-56-0 | ChemIDplus |
| Citations |
|---|