EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22N2O2 |
| Net Charge | 0 |
| Average Mass | 202.298 |
| Monoisotopic Mass | 202.16813 |
| SMILES | CC(C)(CN)C(C)(C)CC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/i1D2,2D2 |
| InChIKey | KDXKERNSBIXSRK-LNLMKGTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS292) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysine-4,4,5,5-d4 (CHEBI:132486) is a deuterated compound (CHEBI:76107) |
| lysine-4,4,5,5-d4 (CHEBI:132486) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (4,4,5,5-2H4)lysine |
| Synonym | Source |
|---|---|
| 4,4,5,5-tetradeuterolysine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 17341139 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10157516 | Reaxys |