EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO5 |
| Net Charge | 0 |
| Average Mass | 457.611 |
| Monoisotopic Mass | 457.28282 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H39NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(29)28-24(27(32)33)22-23-26(30)31/h3-4,6-7,9-10,12-13,15-16,18-19,24H,2,5,8,11,14,17,20-23H2,1H3,(H,28,29)(H,30,31)(H,32,33)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/t24-/m0/s1 |
| InChIKey | NMAOXADCTJAFFT-PJEZTNATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | MetaboLights (MTBLS91) | ||
| - | PubMed (26364855) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl]-L-glutamic acid (CHEBI:132485) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| N-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl]-L-glutamic acid (CHEBI:132485) has role marine metabolite (CHEBI:76507) |
| N-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl]-L-glutamic acid (CHEBI:132485) is a N-(long-chain-fatty-acyl)-L-glutamic acid (CHEBI:21745) |
| Synonyms | Source |
|---|---|
| N-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl]glutamic acid | ChEBI |
| N-(docosahexaenoyl)glutamic acid | ChEBI |
| N-docosahexaenoylglutamic acid | ChEBI |
| N-(docosahexaenoyl)-L-glutamic acid | ChEBI |
| N-(4Z,7Z,10Z,12E,16Z,19Z-docosahexaenoyl)-glutamic acid | LIPID MAPS |
| N-docosahexaenoyl glutamic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020089 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20745818 | Reaxys |
| Citations |
|---|