EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N5O2 |
| Net Charge | 0 |
| Average Mass | 379.464 |
| Monoisotopic Mass | 379.20083 |
| SMILES | C[C@@H]1CN(c2cc(-c3nnc4ccc(OC5(C)CC5)cc34)ncn2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H25N5O2/c1-13-10-26(11-14(2)27-13)19-9-18(22-12-23-19)20-16-8-15(28-21(3)6-7-21)4-5-17(16)24-25-20/h4-5,8-9,12-14H,6-7,10-11H2,1-3H3,(H,24,25)/t13-,14+ |
| InChIKey | ATUUNJCZCOMUKD-OKILXGFUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MLI-2 (CHEBI:132484) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| MLI-2 (CHEBI:132484) is a aromatic ether (CHEBI:35618) |
| MLI-2 (CHEBI:132484) is a cyclopropanes (CHEBI:51454) |
| MLI-2 (CHEBI:132484) is a indazoles (CHEBI:38769) |
| MLI-2 (CHEBI:132484) is a morpholines (CHEBI:38785) |
| MLI-2 (CHEBI:132484) is a pyrimidines (CHEBI:39447) |
| MLI-2 (CHEBI:132484) is a tertiary amino compound (CHEBI:50996) |
| Synonym | Source |
|---|---|
| cis-2,6-dimethyl-4-(6-(5-(1-methylcyclopropoxy)-1H-indazol-3-yl)pyrimidin-4-yl)morpholine | ChEBI |
| Citations |
|---|