EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O3 |
| Net Charge | 0 |
| Average Mass | 330.468 |
| Monoisotopic Mass | 330.21949 |
| SMILES | [H][C@@]12CCc3c(OC)c(C(C)C)cc(O)c3[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C21H30O3/c1-12(2)14-11-15(22)18-13(19(14)24-6)7-8-16-20(3,4)17(23)9-10-21(16,18)5/h11-12,16,22H,7-10H2,1-6H3/t16-,21-/m0/s1 |
| InChIKey | SPNKZMRXBVCONG-KKSFZXQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | PubMed (22256754) | |
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (18554602) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptonoterpene methyl ether (CHEBI:132483) has role plant metabolite (CHEBI:76924) |
| triptonoterpene methyl ether (CHEBI:132483) is a abietane diterpenoid (CHEBI:36762) |
| triptonoterpene methyl ether (CHEBI:132483) is a aromatic ether (CHEBI:35618) |
| triptonoterpene methyl ether (CHEBI:132483) is a carbotricyclic compound (CHEBI:38032) |
| triptonoterpene methyl ether (CHEBI:132483) is a cyclic ketone (CHEBI:3992) |
| triptonoterpene methyl ether (CHEBI:132483) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 11-hydroxy-14-methoxyabieta-8(14),9(11),12-trien-3-one |
| Synonym | Source |
|---|---|
| 11-hydroxy-14-methoxyabieta-8,11,13-trien-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7386633 | Reaxys |
| Citations |
|---|