EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O5 |
| Net Charge | 0 |
| Average Mass | 342.391 |
| Monoisotopic Mass | 342.14672 |
| SMILES | CC(C)c1cc(O)c2c(c1O)C(=O)CC1C3=C(CC[C@]21C)C(=O)OC3 |
| InChI | InChI=1S/C20H22O5/c1-9(2)11-6-15(22)17-16(18(11)23)14(21)7-13-12-8-25-19(24)10(12)4-5-20(13,17)3/h6,9,13,22-23H,4-5,7-8H2,1-3H3/t13?,20-/m0/s1 |
| InChIKey | WEYINIKPYXLZCS-JDOQCHFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | root (BTO:0001188) | Article (Phytochemistry, 1997, 46(3), 535-543.) | From dried root outer bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptobenzene K (CHEBI:132482) has role plant metabolite (CHEBI:76924) |
| triptobenzene K (CHEBI:132482) is a benzenediols (CHEBI:33570) |
| triptobenzene K (CHEBI:132482) is a cyclic ketone (CHEBI:3992) |
| triptobenzene K (CHEBI:132482) is a tetracyclic diterpenoid (CHEBI:52557) |
| triptobenzene K (CHEBI:132482) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bR,9bS)-6,9-dihydroxy-7-isopropyl-9b-methyl-3,3b,4,9b,10,11-hexahydrophenanthro[1,2-c]furan-1,5-dione |
| Synonym | Source |
|---|---|
| 3β,14,19-trihydroxy-abieta-8,11,13-triene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 101936047 | PubChem Compound |