EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28O3 |
| Net Charge | 0 |
| Average Mass | 244.375 |
| Monoisotopic Mass | 244.20384 |
| SMILES | CC(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O3/c1-13(15)11-9-7-5-3-2-4-6-8-10-12-14(16)17/h13,15H,2-12H2,1H3,(H,16,17) |
| InChIKey | KNFJWKJXKURGQU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10553002) | |
| Neisseria gonorrhoeae (ncbitaxon:485) | - | PubMed (4990768) | |
| Neisseria meningitidis (ncbitaxon:487) | - | PubMed (4990768) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) has functional parent tetradecanoic acid (CHEBI:28875) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) has role bacterial metabolite (CHEBI:76969) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) has role human xenobiotic metabolite (CHEBI:76967) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) is a long-chain fatty acid (CHEBI:15904) |
| 13-hydroxytetradecanoic acid (CHEBI:132473) is conjugate acid of 13-hydroxytetradecanoate (CHEBI:132031) |
| Incoming Relation(s) |
| 13-hydroxytetradecanoate (CHEBI:132031) is conjugate base of 13-hydroxytetradecanoic acid (CHEBI:132473) |
| IUPAC Name |
|---|
| 13-hydroxytetradecanoic acid |
| Synonym | Source |
|---|---|
| 13-hydroxymyristic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2440970 | Reaxys |
| Citations |
|---|