EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132472 - 18-hydroxylinoleic acid
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | O=C(O)CCCCCCC/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C18H32O3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-2,5,7,19H,3-4,6,8-17H2,(H,20,21)/b2-1-,7-5- |
| InChIKey | KPBOLLJJMHIJPH-PQZOIKATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neurospora crassa (ncbitaxon:5141) | - | PubMed (26859959) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10553002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxylinoleic acid (CHEBI:132472) has functional parent linoleic acid (CHEBI:17351) |
| 18-hydroxylinoleic acid (CHEBI:132472) has role fungal metabolite (CHEBI:76946) |
| 18-hydroxylinoleic acid (CHEBI:132472) has role human xenobiotic metabolite (CHEBI:76967) |
| 18-hydroxylinoleic acid (CHEBI:132472) is a polyunsaturated fatty acid (CHEBI:26208) |
| 18-hydroxylinoleic acid (CHEBI:132472) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 18-hydroxylinoleic acid (CHEBI:132472) is conjugate acid of 18-hydroxylinoleate (CHEBI:132029) |
| Incoming Relation(s) |
| 18-hydroxylinoleate (CHEBI:132029) is conjugate base of 18-hydroxylinoleic acid (CHEBI:132472) |
| IUPAC Name |
|---|
| (9Z,12Z)-18-hydroxyoctadeca-9,12-dienoic acid |
| Synonyms | Source |
|---|---|
| 18-hydroxy-(9Z,12Z)-octadecadienoic acid | ChEBI |
| ω-hydroxylinoleic acid | ChEBI |
| 18-HODE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17376 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14940271 | Reaxys |
| Citations |
|---|