EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O6 |
| Net Charge | 0 |
| Average Mass | 400.471 |
| Monoisotopic Mass | 400.18859 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)C[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | RTZKSTLPRTWFEV-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra chinensis (ncbitaxon:50507) | fruit (BTO:0000486) | PubMed (24155209) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | nephroprotective agent Any protective agent that is able to prevent damage to the kidney. hepatoprotective agent Any compound that is able to prevent damage to the liver. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). anti-asthmatic agent Any compound that has anti-asthmatic effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-schisandrin B (CHEBI:132471) has role anti-asthmatic agent (CHEBI:65023) |
| (+)-schisandrin B (CHEBI:132471) has role anti-inflammatory agent (CHEBI:67079) |
| (+)-schisandrin B (CHEBI:132471) has role antilipemic drug (CHEBI:35679) |
| (+)-schisandrin B (CHEBI:132471) has role antioxidant (CHEBI:22586) |
| (+)-schisandrin B (CHEBI:132471) has role apoptosis inhibitor (CHEBI:68494) |
| (+)-schisandrin B (CHEBI:132471) has role hepatoprotective agent (CHEBI:62868) |
| (+)-schisandrin B (CHEBI:132471) has role nephroprotective agent (CHEBI:76595) |
| (+)-schisandrin B (CHEBI:132471) has role neuroprotective agent (CHEBI:63726) |
| (+)-schisandrin B (CHEBI:132471) has role plant metabolite (CHEBI:76924) |
| (+)-schisandrin B (CHEBI:132471) is a aromatic ether (CHEBI:35618) |
| (+)-schisandrin B (CHEBI:132471) is a cyclic acetal (CHEBI:59770) |
| (+)-schisandrin B (CHEBI:132471) is a organic heterotetracyclic compound (CHEBI:38163) |
| (+)-schisandrin B (CHEBI:132471) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (6R,7S13aR)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydro-11H-benzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxole |
| Synonyms | Source |
|---|---|
| schisandrin B | ChEBI |
| (+)-schizandrin B | ChEBI |
| Schizandrin B | ChemIDplus |
| Wuweizisu B | ChemIDplus |
| γ-schisandrin | ChEBI |
| (+)-γ-schizandrin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5775836 | Reaxys |
| CAS:61281-37-6 | ChemIDplus |
| Citations |
|---|