EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132471 - (+)-schisandrin B
| Formula | C23H28O6 |
| Net Charge | 0 |
| Average Mass | 400.471 |
| Monoisotopic Mass | 400.18859 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)C[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | RTZKSTLPRTWFEV-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Schisandra chinensis (ncbitaxon:50507) | fruit (BTO:0000486) | PubMed (24155209) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-schisandrin B (CHEBI:132471) has role anti-asthmatic agent (CHEBI:65023) |
| (+)-schisandrin B (CHEBI:132471) has role anti-inflammatory agent (CHEBI:67079) |
| (+)-schisandrin B (CHEBI:132471) has role antilipemic drug (CHEBI:35679) |
| (+)-schisandrin B (CHEBI:132471) has role antioxidant (CHEBI:22586) |
| (+)-schisandrin B (CHEBI:132471) has role apoptosis inhibitor (CHEBI:68494) |
| (+)-schisandrin B (CHEBI:132471) has role hepatoprotective agent (CHEBI:62868) |
| (+)-schisandrin B (CHEBI:132471) has role nephroprotective agent (CHEBI:76595) |
| (+)-schisandrin B (CHEBI:132471) has role neuroprotective agent (CHEBI:63726) |
| (+)-schisandrin B (CHEBI:132471) has role plant metabolite (CHEBI:76924) |
| (+)-schisandrin B (CHEBI:132471) is a aromatic ether (CHEBI:35618) |
| (+)-schisandrin B (CHEBI:132471) is a cyclic acetal (CHEBI:59770) |
| (+)-schisandrin B (CHEBI:132471) is a organic heterotetracyclic compound (CHEBI:38163) |
| (+)-schisandrin B (CHEBI:132471) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (6R,7S13aR)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydro-11H-benzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxole |
| Synonyms | Source |
|---|---|
| Wuweizisu B | ChemIDplus |
| Schizandrin B | ChemIDplus |
| γ-schisandrin | ChEBI |
| γ-schizandrin | ChEBI |
| (+)-schizandrin B | ChEBI |
| schisandrin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5775836 | Reaxys |
| CAS:61281-37-6 | ChemIDplus |
| Citations |
|---|