EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H62O4 |
| Net Charge | 0 |
| Average Mass | 546.877 |
| Monoisotopic Mass | 546.46481 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)CC[C@]([H])([C@H](C)CC[C@@H](O)[C@@H](O)[C@@H](O)CO)[C@]4([H])CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C35H62O4/c1-22(9-10-25(37)30(39)26(38)21-36)23-13-18-32(4)24(23)14-19-34(6)28(32)11-12-29-33(5)17-8-16-31(2,3)27(33)15-20-35(29,34)7/h22-30,36-39H,8-21H2,1-7H3/t22-,23-,24+,25-,26+,27+,28-,29-,30-,32+,33+,34-,35-/m1/s1 |
| InChIKey | JMKBTQYGOKJMBJ-ZQPPIKFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ciceribacter lividus (ncbitaxon:1197950) | - | PubMed (23907221) | |
| Desulfovibrio bastinii (ncbitaxon:47157) | - | PubMed (19222571) | |
| Methylobacterium organophilum (ncbitaxon:410) | - | PubMed (26032177) | |
| Rhodopseudomonas palustris TIE-1 (ncbitaxon:395960) | - | PubMed (22221333) | Strain: TIE-1 |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (25918793) | Strain: YIM61470 |
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) has role antimicrobial agent (CHEBI:33281) |
| bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) has role bacterial metabolite (CHEBI:76969) |
| bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) has role lipoxygenase inhibitor (CHEBI:35856) |
| bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) is a hopanoid (CHEBI:51963) |
| bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| 2β-methylbacteriohopane-32,33,34,35-tetrol (CHEBI:132469) has functional parent bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) |
| bacteriohopanetetrol cyclitol ether (CHEBI:132144) has functional parent bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) |
| bacteriohopanetetrol glucosamine (CHEBI:132143) has functional parent bacteriohopane-32,33,34,35-tetrol (CHEBI:132468) |
| IUPAC Name |
|---|
| (2S,3S,4R,7R)-7-[(3R,3aS,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethylicosahydro-1H-cyclopenta[a]chrysen-3-yl]octane-1,2,3,4-tetrol |
| Synonyms | Source |
|---|---|
| 32,33,34,35-bacteriohopanetetrol | ChEBI |
| (32R,33R,34S)-32,33,34,35-bacteriohopanetetrol | ChEBI |
| Bacteriohopanetetrol | KEGG COMPOUND |
| Tetrahydroxybacteriohopane | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C21119 | KEGG COMPOUND |
| CPD-14519 | MetaCyc |
| LMPR04000004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8603395 | Reaxys |
| Citations |
|---|