EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50 |
| Net Charge | 0 |
| Average Mass | 410.730 |
| Monoisotopic Mass | 410.39125 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CCC4=C(C(C)C)CC[C@@]43C)[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C30H50/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20,23-25H,9-19H2,1-8H3/t23-,24+,25+,27-,28-,29+,30+/m0/s1 |
| InChIKey | BJFPMDGPOFJGIR-WWJAXWOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zymomonas mobilis (ncbitaxon:542) | - | PubMed (11377875) | |
| Colysis pothifolia (ncbitaxon:493398) | - | PubMed (26731047) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hop-17(21)-ene (CHEBI:132466) has parent hydride hopane (CHEBI:36482) |
| hop-17(21)-ene (CHEBI:132466) has role bacterial metabolite (CHEBI:76969) |
| hop-17(21)-ene (CHEBI:132466) has role plant metabolite (CHEBI:76924) |
| hop-17(21)-ene (CHEBI:132466) is a triterpene (CHEBI:35191) |
| Incoming Relation(s) |
| 2β-methylhop-17(21)-ene (CHEBI:132467) has functional parent hop-17(21)-ene (CHEBI:132466) |
| IUPAC Name |
|---|
| hop-17(21)-ene |
| Synonym | Source |
|---|---|
| A'-Neogammacer-17(21)-ene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2420300 | Reaxys |
| CAS:546-99-6 | ChemIDplus |
| Citations |
|---|