EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H58O2 |
| Net Charge | 0 |
| Average Mass | 570.902 |
| Monoisotopic Mass | 570.44368 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC2=C(C)C[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H58O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-21,23,35-36,41-42H,22,24-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,29-15+,30-16+,31-19+,32-20+/t35-,36-/m1/s1 |
| InChIKey | ZAYHYNGKERKFHJ-DRCJTWAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amblycipitidae (ncbitaxon:31019) | - | PubMed (12431401) | |
| Bagridae (ncbitaxon:31013) | - | PubMed (12431401) | |
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | PubMed (26364855) | ||
| - | MetaboLights (MTBLS91) | ||
| Callichthyidae (ncbitaxon:31012) | - | PubMed (12431401) | |
| Clariidae (ncbitaxon:31009) | - | PubMed (12431401) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (9470222) | |
| Ictaluridae (ncbitaxon:7996) | - | PubMed (12431401) | |
| Lota lota (ncbitaxon:69944) | - | PubMed (10754789) | |
| Malapteruridae (ncbitaxon:31001) | - | PubMed (12431401) | |
| Plotosidae (ncbitaxon:30997) | - | PubMed (12431401) | |
| Silurus asotus (ncbitaxon:30991) | - | PubMed (21212565) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parasiloxanthin (CHEBI:132452) has role marine metabolite (CHEBI:76507) |
| parasiloxanthin (CHEBI:132452) is a carotenol (CHEBI:23045) |
| parasiloxanthin (CHEBI:132452) is a diol (CHEBI:23824) |
| IUPAC Name |
|---|
| (3R,3'R)-7,8-dihydro-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| 7,8-Dihydro-beta,beta-carotene-3,3'-diol | KNApSAcK |
| 7,8-Dihydrozeaxanthin | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00022866 | KNApSAcK |
| HMDB0036915 | HMDB |
| LMPR01070092 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21132410 | Reaxys |
| CAS:62994-48-3 | KNApSAcK |
| Citations |
|---|