EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H58O2 |
| Net Charge | 0 |
| Average Mass | 570.902 |
| Monoisotopic Mass | 570.44368 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CCCC(C)(C)O)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H58O2/c1-31(19-13-21-33(3)22-14-23-34(4)25-16-28-40(9,10)42)17-11-12-18-32(2)20-15-24-35(5)26-27-38-36(6)29-37(41)30-39(38,7)8/h11-15,17-24,26-27,37,41-42H,16,25,28-30H2,1-10H3/b12-11+,19-13+,20-15+,22-14+,27-26+,31-17+,32-18+,33-21+,34-23+,35-24+/t37-/m1/s1 |
| InChIKey | WDDWAHBJFHEOHV-PNZNGZNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | MetaboLights (MTBLS91) | ||
| - | PubMed (26364855) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,1'-dihydroxy-γ-carotene (CHEBI:132451) has role marine metabolite (CHEBI:76507) |
| 3,1'-dihydroxy-γ-carotene (CHEBI:132451) is a carotenol (CHEBI:23045) |
| 3,1'-dihydroxy-γ-carotene (CHEBI:132451) is a diol (CHEBI:23824) |
| IUPAC Name |
|---|
| (3R)-1',2'-dihydro-β,ψ-carotene-1',3-diol |
| Synonyms | Source |
|---|---|
| 3,1'-(OH)2-γ-carotene | LIPID MAPS |
| 1',3-dihydroxy-γ-carotene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPR01070178 | LIPID MAPS |
| Citations |
|---|