EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4HF9O3S |
| Net Charge | 0 |
| Average Mass | 300.098 |
| Monoisotopic Mass | 299.95027 |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O3S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H,14,15,16) |
| InChIKey | JGTNAGYHADQMCM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorobutanesulfonic acid (CHEBI:132446) has role surfactant (CHEBI:35195) |
| perfluorobutanesulfonic acid (CHEBI:132446) is a perfluoroalkanesulfonic acid (CHEBI:132447) |
| IUPAC Name |
|---|
| nonafluorobutane-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid | ChemIDplus |
| 1-perfluorobutanesulfonic acid | ChemIDplus |
| FC-98 | ChEBI |
| nonafluoro-1-butanesulfonic acid | ChemIDplus |
| nonafluorobutanesulfonic acid | ChemIDplus |
| perfluorobutane-1-sulfonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Perfluorobutanesulfonic_acid | Wikipedia |
| WO2011093371 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1813588 | Reaxys |
| CAS:375-73-5 | ChemIDplus |
| Citations |
|---|