EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O |
| Net Charge | 0 |
| Average Mass | 244.293 |
| Monoisotopic Mass | 244.08882 |
| SMILES | Oc1ccc2ccc3ccc4ccccc4c3c2c1 |
| InChI | InChI=1S/C18H12O/c19-15-10-9-13-6-8-14-7-5-12-3-1-2-4-16(12)18(14)17(13)11-15/h1-11,19H |
| InChIKey | WCFYKAAKPJSBFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[c]phenanthren-2-ol (CHEBI:132443) has role xenobiotic metabolite (CHEBI:76206) |
| benzo[c]phenanthren-2-ol (CHEBI:132443) has role xenoestrogen (CHEBI:76988) |
| benzo[c]phenanthren-2-ol (CHEBI:132443) is a hydroxybenzo[c]phenanthrene (CHEBI:132444) |
| IUPAC Name |
|---|
| benzo[c]phenanthren-2-ol |
| Synonyms | Source |
|---|---|
| 2-hydroxybenzo[c]phenanthrene | ChEBI |
| benzo(c)phenanthren-2-ol | ChemIDplus |
| 2-benzo[c]phenanthrenol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2560490 | Reaxys |
| CAS:22717-94-8 | ChemIDplus |
| Citations |
|---|