EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N5O2 |
| Net Charge | 0 |
| Average Mass | 223.236 |
| Monoisotopic Mass | 223.10692 |
| SMILES | CC(O)C1=Nc2c(nc(N)nc2=O)NC1C |
| InChI | InChI=1S/C9H13N5O2/c1-3-5(4(2)15)12-6-7(11-3)13-9(10)14-8(6)16/h3-4,15H,1-2H3,(H4,10,11,13,14,16) |
| InChIKey | GHRBCDHNYSUFRN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanocaldococcus jannaschii (ncbitaxon:2190) | - | PubMed (25002541) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-6-(1-hydroxyethyl)-7-methyl-7,8-dihydropteridin-4-one (CHEBI:132441) has role bacterial metabolite (CHEBI:76969) |
| 2-amino-6-(1-hydroxyethyl)-7-methyl-7,8-dihydropteridin-4-one (CHEBI:132441) is a aromatic amine (CHEBI:33860) |
| 2-amino-6-(1-hydroxyethyl)-7-methyl-7,8-dihydropteridin-4-one (CHEBI:132441) is a dihydropterin (CHEBI:38797) |
| 2-amino-6-(1-hydroxyethyl)-7-methyl-7,8-dihydropteridin-4-one (CHEBI:132441) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 2-amino-6-(1-hydroxyethyl)-7-methyl-7,8-dihydropteridin-4(1H)-one |
| Synonym | Source |
|---|---|
| 6-hydroxyethyl-7-methylpterin | ChEBI |
| Citations |
|---|