EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40ClNO7 |
| Net Charge | 0 |
| Average Mass | 526.070 |
| Monoisotopic Mass | 525.24933 |
| SMILES | CCCC[C@@H](C)[C@H](O)[C@H](C)C(=O)/C(C)=C/[C@@H](OC)[C@@H](O)[C@@H](OC)C(=O)N/C=C\c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C27H40ClNO7/c1-7-8-9-16(2)23(31)18(4)24(32)17(3)14-22(35-5)25(33)26(36-6)27(34)29-13-12-19-10-11-21(30)20(28)15-19/h10-16,18,22-23,25-26,30-31,33H,7-9H2,1-6H3,(H,29,34)/b13-12-,17-14+/t16-,18+,22-,23+,25-,26-/m1/s1 |
| InChIKey | FYBGSKAWXCBCIQ-JRAUAZSASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces crocatus (ncbitaxon:52) | - | PubMed (19171307) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chondrochloren A (CHEBI:132426) has role antimicrobial agent (CHEBI:33281) |
| chondrochloren A (CHEBI:132426) has role bacterial metabolite (CHEBI:76969) |
| chondrochloren A (CHEBI:132426) is a diol (CHEBI:23824) |
| chondrochloren A (CHEBI:132426) is a enone (CHEBI:51689) |
| chondrochloren A (CHEBI:132426) is a ether (CHEBI:25698) |
| chondrochloren A (CHEBI:132426) is a monocarboxylic acid amide (CHEBI:29347) |
| chondrochloren A (CHEBI:132426) is a monochlorobenzenes (CHEBI:83403) |
| chondrochloren A (CHEBI:132426) is a phenols (CHEBI:33853) |
| chondrochloren A (CHEBI:132426) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,3R,4R,5E,8S,9S,10R)-N-[(Z)-2-(3-chloro-4-hydroxyphenyl)ethenyl]-3,9-dihydroxy-2,4-dimethoxy-6,8,10-trimethyl-7-oxotetradec-5-enamide |
| UniProt Name | Source |
|---|---|
| chondrochloren A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18432 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9530392 | Reaxys |
| Citations |
|---|