EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H35ClN2O11 |
| Net Charge | 0 |
| Average Mass | 683.110 |
| Monoisotopic Mass | 682.19294 |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2cccn2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2Cl)OC1(C)C |
| InChI | InChI=1S/C34H35ClN2O11/c1-16(2)8-9-17-15-18(10-12-21(17)38)30(41)37-24-25(39)19-11-13-22(23(35)27(19)46-32(24)43)45-33-26(40)28(29(44-5)34(3,4)48-33)47-31(42)20-7-6-14-36-20/h6-8,10-15,26,28-29,33,36,38-40H,9H2,1-5H3,(H,37,41)/t26-,28+,29-,33-/m1/s1 |
| InChIKey | PKUNXGQLUGXWJB-ZQZBKPNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces roseochromogenus subsp. oscitans DS 12.976 (ncbitaxon:1352936) | - | PubMed (12898629) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| novclobiocin 109 (CHEBI:132424) has role antimicrobial agent (CHEBI:33281) |
| novclobiocin 109 (CHEBI:132424) has role bacterial metabolite (CHEBI:76969) |
| novclobiocin 109 (CHEBI:132424) is a benzamides (CHEBI:22702) |
| novclobiocin 109 (CHEBI:132424) is a ether (CHEBI:25698) |
| novclobiocin 109 (CHEBI:132424) is a hexoside (CHEBI:35313) |
| novclobiocin 109 (CHEBI:132424) is a hydroxycoumarin (CHEBI:37912) |
| novclobiocin 109 (CHEBI:132424) is a monosaccharide derivative (CHEBI:63367) |
| novclobiocin 109 (CHEBI:132424) is a organochlorine compound (CHEBI:36683) |
| novclobiocin 109 (CHEBI:132424) is a phenols (CHEBI:33853) |
| novclobiocin 109 (CHEBI:132424) is a pyrroles (CHEBI:26455) |
| Synonym | Source |
|---|---|
| (3R,4S,5R,6S)-6-({8-chloro-4-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)benzamido]-2-oxo-2H-1-benzopyran-7-yl}oxy)-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl 1H--pyrrole-2-carboxylate | ChEBI |
| Citations |
|---|