EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O |
| Net Charge | 0 |
| Average Mass | 244.293 |
| Monoisotopic Mass | 244.08882 |
| SMILES | Oc1ccc2c(ccc3c4ccccc4ccc23)c1 |
| InChI | InChI=1S/C18H12O/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h1-11,19H |
| InChIKey | RSBSTIBFPNNSTH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysen-2-ol (CHEBI:132404) has role xenobiotic metabolite (CHEBI:76206) |
| chrysen-2-ol (CHEBI:132404) has role xenoestrogen (CHEBI:76988) |
| chrysen-2-ol (CHEBI:132404) is a hydroxychrysene (CHEBI:132400) |
| IUPAC Name |
|---|
| chrysen-2-ol |
| Synonyms | Source |
|---|---|
| 2-chrysenol | ChemIDplus |
| 2-hydroxychrysene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3283224 | Reaxys |
| CAS:65945-06-4 | ChemIDplus |
| Citations |
|---|