EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O6 |
| Net Charge | 0 |
| Average Mass | 294.303 |
| Monoisotopic Mass | 294.11034 |
| SMILES | COc1cc2oc(=O)ccc2cc1[C@@H](O)[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C15H18O6/c1-15(2,19)14(18)13(17)9-6-8-4-5-12(16)21-10(8)7-11(9)20-3/h4-7,13-14,17-19H,1-3H3/t13-,14+/m1/s1 |
| InChIKey | PCSZTTAMZGNQNB-KGLIPLIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica pubescens (ncbitaxon:312530) | root (BTO:0001188) | PubMed (17238120) | EtOAc-soluble fraction |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| angelitriol (CHEBI:132402) has role plant metabolite (CHEBI:76924) |
| angelitriol (CHEBI:132402) has role platelet aggregation inhibitor (CHEBI:50427) |
| angelitriol (CHEBI:132402) is a aromatic ether (CHEBI:35618) |
| angelitriol (CHEBI:132402) is a coumarins (CHEBI:23403) |
| angelitriol (CHEBI:132402) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 7-methoxy-6-[(1R,2S)-1,2,3-trihydroxy-3-methylbutyl]-2H-chromen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 10017318 | PubChem Compound |
| Citations |
|---|