EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 147.174 |
| Monoisotopic Mass | 147.08954 |
| SMILES | OC[C@H]1NCC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2/t4-,5+,6-/m1/s1 |
| InChIKey | YZNNBIPIQWYLDM-NGJCXOISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | faeces (UBERON:0001988) | PubMed (18323202) | |
| Morus alba (ncbitaxon:3498) | leaf (BTO:0000713) | PubMed (22207282) | |
| Xanthocercis zambesiaca (ncbitaxon:53932) | |||
| leaf (BTO:0000713) | PubMed (9157194) | ||
| root (BTO:0001188) | PubMed (9544568) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.2.1.23 (beta-galactosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of β-galactosidase (EC 3.2.1.23). EC 3.2.1.10 (oligo-1,6-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that inhibits the action of sucrose oligo-1,6-glucosidase (EC 3.2.1.10). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epi-fagomine (CHEBI:132399) has role EC 3.2.1.10 (oligo-1,6-glucosidase) inhibitor (CHEBI:67232) |
| 3-epi-fagomine (CHEBI:132399) has role EC 3.2.1.23 (β-galactosidase) inhibitor (CHEBI:132518) |
| 3-epi-fagomine (CHEBI:132399) has role plant metabolite (CHEBI:76924) |
| 3-epi-fagomine (CHEBI:132399) is a amino monosaccharide (CHEBI:60926) |
| 3-epi-fagomine (CHEBI:132399) is a hydroxypiperidine (CHEBI:48590) |
| 3-epi-fagomine (CHEBI:132399) is a primary alcohol (CHEBI:15734) |
| 3-epi-fagomine (CHEBI:132399) is a secondary alcohol (CHEBI:35681) |
| 3-epi-fagomine (CHEBI:132399) is a secondary amino compound (CHEBI:50995) |
| 3-epi-fagomine (CHEBI:132399) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2R,3R,4S)-2-(hydroxymethyl)piperidine-3,4-diol |
| Synonym | Source |
|---|---|
| 3-epifagomine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00049947 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7072956 | Reaxys |
| CAS:156639-77-9 | KNApSAcK |
| Citations |
|---|