EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O4 |
| Net Charge | 0 |
| Average Mass | 450.619 |
| Monoisotopic Mass | 450.27701 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@@]1(C)[C@@]2(C)CC=C2c3cc(O)c(O)c(C)c3C=C[C@]21C |
| InChI | InChI=1S/C29H38O4/c1-17-18-7-9-27(4)20(19(18)15-21(30)23(17)31)8-10-28(5)22-16-26(3,24(32)33)12-11-25(22,2)13-14-29(27,28)6/h7-9,15,22,30-31H,10-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27-,28+,29-/m1/s1 |
| InChIKey | CBCMYJMFDLVEHM-MNCHQJGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | root (BTO:0001188) | Article (Phytochemistry, 1995, (39), 1159-1163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wilforol B (CHEBI:132379) has role plant metabolite (CHEBI:76924) |
| wilforol B (CHEBI:132379) is a catechols (CHEBI:33566) |
| wilforol B (CHEBI:132379) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| wilforol B (CHEBI:132379) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,6bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6b,9,14a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,14,14a,14b-dodecahydropicene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 10366522 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7343296 | Reaxys |