EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O5 |
| Net Charge | 0 |
| Average Mass | 466.618 |
| Monoisotopic Mass | 466.27192 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=CC(=O)c4c(cc(O)c(O)c4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C29H38O5/c1-16-22-17(13-19(31)23(16)32)27(4)10-12-29(6)21-15-26(3,24(33)34)8-7-25(21,2)9-11-28(29,5)20(27)14-18(22)30/h13-14,21,31-32H,7-12,15H2,1-6H3,(H,33,34)/t21-,25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | MIQDJLKXHZPMHH-CPISFEQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium regelii (ncbitaxon:123485) | stem (BTO:0001300) | PubMed (27425447) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wilforol A (CHEBI:132378) has role plant metabolite (CHEBI:76924) |
| wilforol A (CHEBI:132378) is a catechols (CHEBI:33566) |
| wilforol A (CHEBI:132378) is a cyclic terpene ketone (CHEBI:36130) |
| wilforol A (CHEBI:132378) is a enone (CHEBI:51689) |
| wilforol A (CHEBI:132378) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| wilforol A (CHEBI:132378) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,12bR,14aS,14bR)-10,11-dihydroxy-2,4a,6a,9,12b,14a-hexamethyl-8-oxo-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydropicene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 10096097 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7320132 | Reaxys |
| CAS:167882-66-8 | PubChem Compound |
| Citations |
|---|