EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O4 |
| Net Charge | 0 |
| Average Mass | 454.651 |
| Monoisotopic Mass | 454.30831 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)[C@@]3([H])CCc4c(cc(O)c(O)c4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C29H42O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h15,21-22,30-31H,7-14,16H2,1-6H3,(H,32,33)/t21-,22+,25+,26+,27-,28+,29-/m0/s1 |
| InChIKey | NBMIXMLIGPLJPK-KHYSSQCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium (ncbitaxon:123484) | - | PubMed (17250858) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wilforic acid (CHEBI:132376) has role plant metabolite (CHEBI:76924) |
| wilforic acid (CHEBI:132376) is a catechols (CHEBI:33566) |
| wilforic acid (CHEBI:132376) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| wilforic acid (CHEBI:132376) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aR,6bR,12bR,14aS,14bR)-10,11-dihydroxy-2,4a,6a,9,12b,14a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,12b,13,14,14a,14b-hexadecahydropicene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| wilforic acid A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 101707492 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7779838 | Reaxys |
| Citations |
|---|