EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])C[C@](C)(CO)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)21-9-12-29(6)22(27(21,4)11-10-23(25)32)8-7-19-20-17-26(3,18-31)13-15-30(20,24(33)34)16-14-28(19,29)5/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21-,22+,23-,26+,27-,28+,29+,30-/m0/s1 |
| InChIKey | CZWBKSDPBWNHGO-DPJNYECVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akebia quinata (ncbitaxon:13331) | - | Article (Journal of Natural Products, 52, (1989), 623) | |
| Akebia trifoliata (ncbitaxon:155132) | pericarp (BTO:0001017) | PubMed (p25172756) | |
| Eleutherococcus senticosus (ncbitaxon:82096) | leaf (BTO:0000713) | PubMed (17125224) | |
| Hebanthe paniculata (ncbitaxon:451948) | root (BTO:0001188) | PubMed (19941264) | |
| Stauntonia hexaphylla (ncbitaxon:41788) | - | Article (Journal of Natural Products, 52, (1989), 623) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesembryanthemoidigenic acid (CHEBI:132373) has parent hydride oleanane (CHEBI:36481) |
| mesembryanthemoidigenic acid (CHEBI:132373) has role plant metabolite (CHEBI:76924) |
| mesembryanthemoidigenic acid (CHEBI:132373) is a diol (CHEBI:23824) |
| mesembryanthemoidigenic acid (CHEBI:132373) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| mesembryanthemoidigenic acid (CHEBI:132373) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β)-3,29-dihydroxyolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| 3beta,29-Dihydroxyolean-12-en-28-oic acid | ChemIDplus |
| 3β,29-dihydroxyolean-12-en-28-oic acid | ChEBI |
| AC1O54QP | SUBMITTER |
| Citations |
|---|