EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12C[C@H]3O[C@]34C(C)(C)[C@@H](O)CC[C@@]4([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-24(2)21(31)9-8-18-27(5)13-15-29(7)20-17-26(4,23(32)33)11-10-25(20,3)12-14-28(29,6)19(27)16-22-30(18,24)34-22/h18-22,31H,8-17H2,1-7H3,(H,32,33)/t18-,19-,20+,21-,22+,25+,26+,27-,28+,29-,30-/m0/s1 |
| InChIKey | ICXWWEDNOSYVIP-FOACAYPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | Article (Phytochem., 49, (1998), 1821) | |
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | Article (Phytochem., 53, (2000), 715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptocallic acid C (CHEBI:132372) has role plant metabolite (CHEBI:76924) |
| triptocallic acid C (CHEBI:132372) is a epoxy monocarboxylic acid (CHEBI:23931) |
| triptocallic acid C (CHEBI:132372) is a hexacyclic triterpenoid (CHEBI:70994) |
| triptocallic acid C (CHEBI:132372) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (3R,4aR,4bS,6aR,6bS,9S,10aR,11aR,12aS,12bR,14aS)-9-hydroxy-3,4b,6a,10,10,12b,14a-heptamethylicosahydro-2H-piceno[4a,5-b]oxirene-3-carboxylic acid |
| Synonym | Source |
|---|---|
| (+)-Triptocallic acid C | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00037952 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8527236 | Reaxys |
| CAS:201534-08-9 | KNApSAcK |