EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132371 - triptocallic acid D
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])C[C@](C)(C(=O)O)C[C@H](O)[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)20-10-13-30(7)21(28(20,5)12-11-22(25)31)9-8-18-19-16-26(3,24(33)34)17-23(32)27(19,4)14-15-29(18,30)6/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20-,21+,22+,23-,26-,27+,28-,29+,30+/m0/s1 |
| InChIKey | JTBGJQZJEYVBJZ-SXKKXCELSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | Article (Phytochem., 53, (2000), 715) | |
| Tripterygium wilfordii (ncbitaxon:458696) | - | Article (Phytochem., 53, (2000), 805) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptocallic acid D (CHEBI:132371) has parent hydride oleanane (CHEBI:36481) |
| triptocallic acid D (CHEBI:132371) has role plant metabolite (CHEBI:76924) |
| triptocallic acid D (CHEBI:132371) is a diol (CHEBI:23824) |
| triptocallic acid D (CHEBI:132371) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| triptocallic acid D (CHEBI:132371) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3α,22α)-3,22-dihydroxyolean-12-en-29-oic acid |
| Synonym | Source |
|---|---|
| 3α,22α-dihydroxyolean-12-en-29-oic acid | ChEBI |
| Citations |
|---|