EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132366 - methyl 3,4-dihydroxybenzoate
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| InChIKey | CUFLZUDASVUNOE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nauclea orientalis (ncbitaxon:43526) | stem (BTO:0001300) | PubMed (26749820) | |
| Senna italica (ncbitaxon:346974) | aerial part (BTO:0001658) | PubMed (24684761) | |
| Sorghum bicolor (ncbitaxon:4558) | seed (BTO:0001226) | PubMed (25172742) | |
| Tagetes patula (ncbitaxon:55843) | flower (BTO:0000469) | PubMed (25539472) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) has functional parent 3,4-dihydroxybenzoic acid (CHEBI:36062) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) has role antioxidant (CHEBI:22586) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) has role neuroprotective agent (CHEBI:63726) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) has role plant metabolite (CHEBI:76924) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) is a catechols (CHEBI:33566) |
| methyl 3,4-dihydroxybenzoate (CHEBI:132366) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 3,4-dihydroxybenzoate |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxybenzoic acid methyl ester | ChemIDplus |
| MDHB | ChEBI |
| methyl protocatechuate | ChemIDplus |
| protocatechuic acid, methyl ester | ChemIDplus |
| Citations |
|---|