EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | CCOC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O4/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5,10-11H,2H2,1H3 |
| InChIKey | KBPUBCVJHFXPOC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arachis hypogaea (ncbitaxon:3818) | seed (BTO:0001226) | PubMed (12670184) | Found in seed testa |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of procollagen-proline dioxygenase (EC 1.14.11.2). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has functional parent 3,4-dihydroxybenzoic acid (CHEBI:36062) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has role antibacterial agent (CHEBI:33282) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has role antioxidant (CHEBI:22586) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has role apoptosis inducer (CHEBI:68495) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has role EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor (CHEBI:132365) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) has role plant metabolite (CHEBI:76924) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) is a catechols (CHEBI:33566) |
| ethyl 3,4-dihydroxybenzoate (CHEBI:132364) is a ethyl ester (CHEBI:23990) |
| IUPAC Name |
|---|
| ethyl 3,4-dihydroxybenzoate |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxybenzoic acid ethyl ester | ChEBI |
| EDHB | ChEBI |
| ethyl protocatechuate | ChemIDplus |
| protocatechuic acid ethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Ethyl_protocatechuate | Wikipedia |
| Citations |
|---|