EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16ClF3N10O2 |
| Net Charge | 0 |
| Average Mass | 544.885 |
| Monoisotopic Mass | 544.10983 |
| SMILES | CNC(=O)c1cc(C#N)cc(C)c1NC(=O)c1cc(Cn2nnc(C(F)(F)F)n2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C22H16ClF3N10O2/c1-11-6-12(9-27)7-14(19(37)28-2)17(11)30-20(38)16-8-13(10-35-33-21(31-34-35)22(24,25)26)32-36(16)18-15(23)4-3-5-29-18/h3-8H,10H2,1-2H3,(H,28,37)(H,30,38) |
| InChIKey | KNDVJPKNBVIKML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ryanodine receptor agonist A ryanodine receptor modulator which activates the receptor. Ryanodine receptors (RyRs) act as selective ion channels, modulating the release of calcium. Activating the receptors causes the release of calcium, so depleting internal calcium and ultimately preventing further muscle contraction. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetraniliprole (CHEBI:132355) has role ryanodine receptor agonist (CHEBI:67114) |
| tetraniliprole (CHEBI:132355) is a nitrile (CHEBI:18379) |
| tetraniliprole (CHEBI:132355) is a organochlorine compound (CHEBI:36683) |
| tetraniliprole (CHEBI:132355) is a organofluorine compound (CHEBI:37143) |
| tetraniliprole (CHEBI:132355) is a pyrazole insecticide (CHEBI:26409) |
| tetraniliprole (CHEBI:132355) is a pyridines (CHEBI:26421) |
| tetraniliprole (CHEBI:132355) is a secondary carboxamide (CHEBI:140325) |
| tetraniliprole (CHEBI:132355) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 1-(3-chloropyridin-2-yl)-N-[4-cyano-2-methyl-6-(methylcarbamoyl)phenyl]-3-{[5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl}-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 1-(3-chloro-2-pyridyl)-4'-cyano-2'-methyl-6'-methylcarbamoyl-3-{[5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl}pyrazole-5-carboxanilide | Alan Wood's Pesticides |
| 1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-methyl-6-[(methylamino)carbonyl]phenyl]-3-[[5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl]-1H-pyrazole-5-carboxamide | Alan Wood's Pesticides |
| tétraniliprole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| tetraniliprole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20726982 | Reaxys |
| CAS:1229654-66-3 | ChemIDplus |
| CAS:1229654-66-3 | Alan Wood's Pesticides |