EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@@]12CCC3=C(C(=O)C=C(C(C)C)C3=O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C20H26O3/c1-11(2)13-10-14(21)17-12(18(13)23)6-7-15-19(3,4)16(22)8-9-20(15,17)5/h10-11,15H,6-9H2,1-5H3/t15-,20-/m0/s1 |
| InChIKey | JRDCNBZYYIEMRB-YWZLYKJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | PubMed (Phytochemistry, 2000, 53, 715-722.) | |
| Tripterygium doianum (ncbitaxon:859951) | - | PubMed (Phytochemistry, 2004, 65, 2071) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptoquinone H (CHEBI:132354) has role plant metabolite (CHEBI:76924) |
| triptoquinone H (CHEBI:132354) is a p-quinones (CHEBI:25830) |
| triptoquinone H (CHEBI:132354) is a abietane diterpenoid (CHEBI:36762) |
| triptoquinone H (CHEBI:132354) is a carbotricyclic compound (CHEBI:38032) |
| triptoquinone H (CHEBI:132354) is a cyclic terpene ketone (CHEBI:36130) |
| triptoquinone H (CHEBI:132354) is a tricyclic diterpenoid (CHEBI:79084) |
| Manual Xrefs | Databases |
|---|---|
| C00035884 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8505686 | Reaxys |
| CAS:268541-23-7 | KNApSAcK |