EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@@]12CCC3=C(C(=O)C=C(C(C)C)C3=O)[C@@]1(C)CCC(=O)[C@]2(C)CO |
| InChI | InChI=1S/C20H26O4/c1-11(2)13-9-14(22)17-12(18(13)24)5-6-15-19(17,3)8-7-16(23)20(15,4)10-21/h9,11,15,21H,5-8,10H2,1-4H3/t15-,19+,20-/m1/s1 |
| InChIKey | RYYRZMIBKOKIRO-UIAACRFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (10579865) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptoquinone B (CHEBI:132353) has role plant metabolite (CHEBI:76924) |
| triptoquinone B (CHEBI:132353) is a p-quinones (CHEBI:25830) |
| triptoquinone B (CHEBI:132353) is a abietane diterpenoid (CHEBI:36762) |
| triptoquinone B (CHEBI:132353) is a carbotricyclic compound (CHEBI:38032) |
| triptoquinone B (CHEBI:132353) is a cyclic terpene ketone (CHEBI:36130) |
| triptoquinone B (CHEBI:132353) is a primary alcohol (CHEBI:15734) |
| triptoquinone B (CHEBI:132353) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| 19-hydroxyabieta-8,12-diene-3,11,14-trione |
| Manual Xrefs | Databases |
|---|---|
| C00035883 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5448379 | Reaxys |
| CAS:142937-50-6 | KNApSAcK |
| Citations |
|---|