EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12CCc3c(ccc(C(C)C)c3O)[C@@]1(C)CCC(=O)[C@]2(C)CO |
| InChI | InChI=1S/C20H28O3/c1-12(2)13-5-7-15-14(18(13)23)6-8-16-19(15,3)10-9-17(22)20(16,4)11-21/h5,7,12,16,21,23H,6,8-11H2,1-4H3/t16-,19-,20-/m1/s1 |
| InChIKey | TZJRHFCKOBGRSH-NSISKUIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (21514608) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptobenzene A (CHEBI:132349) has role plant metabolite (CHEBI:76924) |
| triptobenzene A (CHEBI:132349) is a abietane diterpenoid (CHEBI:36762) |
| triptobenzene A (CHEBI:132349) is a cyclic terpene ketone (CHEBI:36130) |
| triptobenzene A (CHEBI:132349) is a phenols (CHEBI:33853) |
| triptobenzene A (CHEBI:132349) is a primary alcohol (CHEBI:15734) |
| triptobenzene A (CHEBI:132349) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| 14,19-dihydroxyabieta-8,11,13-trien-3-one |
| Citations |
|---|