EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@@]12CCc3c(ccc(C(C)C)c3O)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C20H28O2/c1-12(2)13-6-8-15-14(18(13)22)7-9-16-19(3,4)17(21)10-11-20(15,16)5/h6,8,12,16,22H,7,9-11H2,1-5H3/t16-,20+/m0/s1 |
| InChIKey | WENIWZBFJBCNNG-OXJNMPFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (17265278) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptonoterpene (CHEBI:132348) has role plant metabolite (CHEBI:76924) |
| triptonoterpene (CHEBI:132348) is a abietane diterpenoid (CHEBI:36762) |
| triptonoterpene (CHEBI:132348) is a carbotricyclic compound (CHEBI:38032) |
| triptonoterpene (CHEBI:132348) is a cyclic terpene ketone (CHEBI:36130) |
| triptonoterpene (CHEBI:132348) is a phenols (CHEBI:33853) |
| triptonoterpene (CHEBI:132348) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| 14-hydroxyabieta-8(14),9(11),12-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| C00035772 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7432793 | Reaxys |
| CAS:99694-87-8 | KNApSAcK |
| Citations |
|---|