EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O4 |
| Net Charge | 0 |
| Average Mass | 326.392 |
| Monoisotopic Mass | 326.15181 |
| SMILES | [H][C@]12CC(=O)c3c(ccc(C(C)C)c3O)[C@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C20H22O4/c1-10(2)11-4-5-14-17(18(11)22)16(21)8-15-13-9-24-19(23)12(13)6-7-20(14,15)3/h4-5,10,15,22H,6-9H2,1-3H3/t15-,20+/m1/s1 |
| InChIKey | MHZZHUMKOAYLPH-QRWLVFNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (7304185) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptonolide (CHEBI:132347) has role plant metabolite (CHEBI:76924) |
| triptonolide (CHEBI:132347) is a aromatic ketone (CHEBI:76224) |
| triptonolide (CHEBI:132347) is a cyclic terpene ketone (CHEBI:36130) |
| triptonolide (CHEBI:132347) is a organic heterotetracyclic compound (CHEBI:38163) |
| triptonolide (CHEBI:132347) is a phenols (CHEBI:33853) |
| triptonolide (CHEBI:132347) is a tetracyclic triterpenoid (CHEBI:26893) |
| triptonolide (CHEBI:132347) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bR,9bS)-6-hydroxy-9b-methyl-7-(propan-2-yl)-3,3b,4,9b,10,11-hexahydrophenanthro[1,2-c]furan-1,5-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7440891 | Reaxys |
| Citations |
|---|