EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O4 |
| Net Charge | 0 |
| Average Mass | 342.435 |
| Monoisotopic Mass | 342.18311 |
| SMILES | [H][C@@]12CCc3c(OC)c(C(C)C)cc(O)c3[C@@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C21H26O4/c1-11(2)14-9-17(22)18-13(19(14)24-4)5-6-16-15-10-25-20(23)12(15)7-8-21(16,18)3/h9,11,16,22H,5-8,10H2,1-4H3/t16-,21-/m0/s1 |
| InChIKey | YQHBJMHUMJXFDN-KKSFZXQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | PubMed (Phytochemistry, 2000, 53, 715-722.) | |
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (7102323) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neotriptophenolide (CHEBI:132346) has role plant metabolite (CHEBI:76924) |
| neotriptophenolide (CHEBI:132346) is a aromatic ether (CHEBI:35618) |
| neotriptophenolide (CHEBI:132346) is a organic heterotetracyclic compound (CHEBI:38163) |
| neotriptophenolide (CHEBI:132346) is a phenols (CHEBI:33853) |
| neotriptophenolide (CHEBI:132346) is a tetracyclic triterpenoid (CHEBI:26893) |
| neotriptophenolide (CHEBI:132346) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3bR,9bS)-9-hydroxy-6-methoxy-9b-methyl-7-(propan-2-yl)-3b,4,5,9b,10,11-hexahydrophenanthro[1,2-c]furan-1(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7391194 | Reaxys |
| CAS:81827-74-9 | KNApSAcK |
| CAS:81827-74-9 | ChemIDplus |
| Citations |
|---|