EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@@]12OCC[C@@]3([H])[C@]4(C)CC[C@@]5(C)[C@]6([H])C[C@](C)(C(=O)O)CC[C@]6(C)CC[C@]5(C)[C@@]4([H])CC[C@@]13[C@@H](C)C(=O)O2 |
| InChI | InChI=1S/C30H46O5/c1-18-22(31)35-24-30(18)9-7-19-27(4,20(30)8-16-34-24)13-15-29(6)21-17-26(3,23(32)33)11-10-25(21,2)12-14-28(19,29)5/h18-21,24H,7-17H2,1-6H3,(H,32,33)/t18-,19-,20-,21+,24-,25+,26+,27+,28+,29-,30-/m0/s1 |
| InChIKey | MHUNAMWYXWYEMX-PLTLGRIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | Article (Duan, H., Kawazoe, K., Bando, M., Kido, M., Takaishi, Y. (1997) Di- and triterpenoids from Tripterygium hypoglaucum. Phytochemistry 46, 535-543.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celastolide (CHEBI:132344) has role plant metabolite (CHEBI:76924) |
| celastolide (CHEBI:132344) is a hexacyclic triterpenoid (CHEBI:70994) |
| celastolide (CHEBI:132344) is a monocarboxylic acid (CHEBI:25384) |
| celastolide (CHEBI:132344) is a organic heterohexacyclic compound (CHEBI:51914) |
| celastolide (CHEBI:132344) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6R,6aR,8aS,8bR,10aS,13R,14aR,14bS,16aR,16bS)-6,8b,10a,13,14b,16a-hexamethyl-5-oxoicosahydro-2H,3aH-chryseno[2,1-c]furo[2,3-b]pyran-13-carboxylic acid |
| Synonym | Source |
|---|---|
| celastoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7837734 | Reaxys |