EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O2 |
| Net Charge | 0 |
| Average Mass | 456.755 |
| Monoisotopic Mass | 456.39673 |
| SMILES | [H][C@]12[C@H](OC)C=C3[C@]4([H])CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C31H52O2/c1-26(2)14-15-28(5)16-17-30(7)20(21(28)19-26)18-22(33-9)25-29(6)12-11-24(32)27(3,4)23(29)10-13-31(25,30)8/h18,21-25,32H,10-17,19H2,1-9H3/t21-,22+,23-,24-,25+,28+,29-,30+,31+/m0/s1 |
| InChIKey | VKGXBRHZFJRMOC-BCZIGNCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | leaf (BTO:0000713) | Article (Phytochemistry, 2000, 53, 715-722.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptohypol F (CHEBI:132343) has parent hydride oleanane (CHEBI:36481) |
| triptohypol F (CHEBI:132343) has role plant metabolite (CHEBI:76924) |
| triptohypol F (CHEBI:132343) is a ether (CHEBI:25698) |
| triptohypol F (CHEBI:132343) is a pentacyclic triterpenoid (CHEBI:25872) |
| triptohypol F (CHEBI:132343) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,11α)-11-methoxyolean-12-en-3-ol |
| Synonyms | Source |
|---|---|
| 11-Methoxy-12-oleanen-3-ol | HMDB |
| 3β-hydroxy-11α-methoxyolean-12-ene | ChEBI |
| 11α-methoxyolean-12-en-3β-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035495 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8524112 | Reaxys |
| CAS:268541-26-0 | HMDB |