EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O2 |
| Net Charge | 0 |
| Average Mass | 456.755 |
| Monoisotopic Mass | 456.39673 |
| SMILES | [H][C@]12[C@H](OC)C=C3[C@@](C)(CC[C@@]4(C)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C31H52O2/c1-19-10-13-28(5)16-17-30(7)21(25(28)20(19)2)18-22(33-9)26-29(6)14-12-24(32)27(3,4)23(29)11-15-31(26,30)8/h18-20,22-26,32H,10-17H2,1-9H3/t19-,20+,22-,23+,24+,25+,26-,28-,29+,30-,31-/m1/s1 |
| InChIKey | DNPBJHZABOJXGA-HPBGPLOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | root (BTO:0001188) | PubMed (10746886) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptohypol E (CHEBI:132342) has parent hydride ursane (CHEBI:35711) |
| triptohypol E (CHEBI:132342) has role plant metabolite (CHEBI:76924) |
| triptohypol E (CHEBI:132342) is a ether (CHEBI:25698) |
| triptohypol E (CHEBI:132342) is a pentacyclic triterpenoid (CHEBI:25872) |
| triptohypol E (CHEBI:132342) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,11α)-11-methoxyurs-12-en-3-ol |
| Synonym | Source |
|---|---|
| 3β-hydroxy-11α-methoxyurs-12-ene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8524798 | Reaxys |
| Citations |
|---|