EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12[C@H](O)CC3=C4CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-25(2)13-14-27(5)15-16-29(7)19(20(27)18-25)17-21(31)24-28(6)11-10-23(32)26(3,4)22(28)9-12-30(24,29)8/h21-24,31-32H,9-18H2,1-8H3/t21-,22+,23+,24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | PLLRCYPRRCRXHG-KQCVGMHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | Article (Phytochemistry, 2000, 53, 715-722.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypodiol (CHEBI:132341) has parent hydride oleanane (CHEBI:36481) |
| hypodiol (CHEBI:132341) has role plant metabolite (CHEBI:76924) |
| hypodiol (CHEBI:132341) is a diol (CHEBI:23824) |
| hypodiol (CHEBI:132341) is a pentacyclic triterpenoid (CHEBI:25872) |
| hypodiol (CHEBI:132341) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,11α)-olean-13(18)-ene-3,11-diol |
| Synonyms | Source |
|---|---|
| (-)-Hypodiol | KNApSAcK |
| 3β,11α-dihydroxy-olean-13(18)-ene | ChEBI |
| olean-13(18)-ene-3β,11α-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7828737 | Reaxys |
| CAS:198129-86-1 | ChemIDplus |