EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O4 |
| Net Charge | 0 |
| Average Mass | 452.635 |
| Monoisotopic Mass | 452.29266 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=CCc4c(cc(O)c(O)c4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C29H40O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h8,15,22,30-31H,7,9-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | WZAUFGYINZYCKH-JJWQIEBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium regelii (ncbitaxon:123485) | bark (BTO:0001301) | PubMed (20167482) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptohypol C (CHEBI:132340) has role apoptosis inducer (CHEBI:68495) |
| triptohypol C (CHEBI:132340) has role plant metabolite (CHEBI:76924) |
| triptohypol C (CHEBI:132340) is a benzenediols (CHEBI:33570) |
| triptohypol C (CHEBI:132340) is a monocarboxylic acid (CHEBI:25384) |
| triptohypol C (CHEBI:132340) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,12bS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,9,12b,14a-hexamethyl-1,2,3,4,4a,5,6,6a,8,12b,13,14,14a,14b-tetradecahydropicene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| dihydrocelastrol | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 10411574 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3181751 | Reaxys |
| Citations |
|---|