EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O2 |
| Net Charge | 0 |
| Average Mass | 470.782 |
| Monoisotopic Mass | 470.41238 |
| SMILES | [H][C@]12[C@H](OCC)C=C3[C@@](C)(CC[C@@]4(C)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C32H54O2/c1-10-34-23-19-22-26-21(3)20(2)11-14-29(26,6)17-18-31(22,8)32(9)16-12-24-28(4,5)25(33)13-15-30(24,7)27(23)32/h19-21,23-27,33H,10-18H2,1-9H3/t20-,21+,23-,24+,25+,26+,27-,29-,30+,31-,32-/m1/s1 |
| InChIKey | LQLVWNVASQPJTG-VYOOLRBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | root (BTO:0001188) | PubMed (10746886) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptohypol D (CHEBI:132339) has parent hydride ursane (CHEBI:35711) |
| triptohypol D (CHEBI:132339) has role plant metabolite (CHEBI:76924) |
| triptohypol D (CHEBI:132339) is a ether (CHEBI:25698) |
| triptohypol D (CHEBI:132339) is a pentacyclic triterpenoid (CHEBI:25872) |
| triptohypol D (CHEBI:132339) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3β,11α)-11-ethoxyurs-12-en-3-ol |
| Synonym | Source |
|---|---|
| 3β-hydroxy-11α-ethoxyurs-12-ene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 101062653 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8525025 | Reaxys |
| Citations |
|---|