EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O7 |
| Net Charge | 0 |
| Average Mass | 378.421 |
| Monoisotopic Mass | 378.16785 |
| SMILES | [H][C@@]12C[C@@H]3O[C@@]34[C@H](O)[C@](O)(C(C)C)[C@H](O)[C@@H]3O[C@@]34[C@@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C20H26O7/c1-8(2)18(24)13(21)14-20(27-14)17(3)5-4-9-10(7-25-15(9)22)11(17)6-12-19(20,26-12)16(18)23/h8,11-14,16,21,23-24H,4-7H2,1-3H3/t11-,12-,13+,14-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | DYVDZVMUDBCZSA-LZVGCMTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | leaf (BTO:0000713) | PubMed (10716597) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptriolide (CHEBI:132336) has role anti-inflammatory agent (CHEBI:67079) |
| triptriolide (CHEBI:132336) has role plant metabolite (CHEBI:76924) |
| triptriolide (CHEBI:132336) is a abietane diterpenoid (CHEBI:36762) |
| triptriolide (CHEBI:132336) is a epoxide (CHEBI:32955) |
| triptriolide (CHEBI:132336) is a triol (CHEBI:27136) |
| triptriolide (CHEBI:132336) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1aS,1bS,6bS,7aS,8aS,9R,10S,11R,11aS)-9,10,11-trihydroxy-1b-methyl-10-(propan-2-yl)-1b,3,6,6b,7,7a,9,10,11,11a-decahydrobisoxireno[8a,9:4b,5]phenanthro[1,2-c]furan-4(2H)-one |
| Manual Xrefs | Databases |
|---|---|
| 58636974 | PubChem Compound |
| C00034731 | KNApSAcK |
| US2004018260 | Patent |
| WO0217931 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6826738 | Reaxys |
| CAS:137131-18-1 | KNApSAcK |
| Citations |
|---|